C32H31FN2O12S2 — CID 163213528
methyl 2-[5-[3-[5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxypropylsulfanyl]-1,3,4-oxadiazol-2-yl]-3-fluorobenzenesulfonate (PubChem CID 163213528) has the molecular formula C32H31FN2O12S2 and a molecular weight of 718.73 g/mol. Its IUPAC name is methyl 2-[5-[3-[5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxypropylsulfanyl]-1,3,4-oxadiazol-2-yl]-3-fluorobenzenesulfonate.
| Compound Name | methyl 2-[5-[3-[5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxypropylsulfanyl]-1,3,4-oxadiazol-2-yl]-3-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 163213528 |
| Molecular Formula | C32H31FN2O12S2 |
| Molecular Weight | 718.73 g/mol |
| Exact Mass | 718.13 |
| IUPAC Name | methyl 2-[5-[3-[5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxypropylsulfanyl]-1,3,4-oxadiazol-2-yl]-3-fluorobenzenesulfonate |
| SMILES | COc1cc(OC)c2c(=O)c(OCCCSc3nnc(-c4c(F)cccc4S(=O)(=O)OC)o3)c(-c3cc(OC)c(OC)c(OC)c3)oc2c1 |
| InChI | InChI=1S/C32H31FN2O12S2/c1-39-18-15-20(40-2)26-21(16-18)46-28(17-13-22(41-3)29(43-5)23(14-17)42-4)30(27(26)36)45-11-8-12-48-32-35-34-31(47-32)25-19(33)9-7-10-24(25)49(37,38)44-6/h7,9-10,13-16H,8,11-12H2,1-6H3 |
| InChIKey | ZCQBUKHMOHDWOA-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 167.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.73 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|