C20H21F2N3O4S — CID 163234009
1-[3,4-difluoro-5-(methoxymethoxy)phenyl]-5-piperidin-1-ylsulfonylindazole (PubChem CID 163234009) has the molecular formula C20H21F2N3O4S and a molecular weight of 437.47 g/mol. Its IUPAC name is 1-[3,4-difluoro-5-(methoxymethoxy)phenyl]-5-piperidin-1-ylsulfonylindazole.
| Compound Name | 1-[3,4-difluoro-5-(methoxymethoxy)phenyl]-5-piperidin-1-ylsulfonylindazole |
|---|---|
| PubChem CID | 163234009 |
| Molecular Formula | C20H21F2N3O4S |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 1-[3,4-difluoro-5-(methoxymethoxy)phenyl]-5-piperidin-1-ylsulfonylindazole |
| SMILES | COCOc1cc(-n2ncc3cc(S(=O)(=O)N4CCCCC4)ccc32)cc(F)c1F |
| InChI | InChI=1S/C20H21F2N3O4S/c1-28-13-29-19-11-15(10-17(21)20(19)22)25-18-6-5-16(9-14(18)12-23-25)30(26,27)24-7-3-2-4-8-24/h5-6,9-12H,2-4,7-8,13H2,1H3 |
| InChIKey | YJYUGJSPYAVWLN-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|