C15H26N2 — CID 163245894
(Z)-3-(2,6-dimethylcyclohexa-1,5-dien-1-yl)-3-ethyliminoprop-1-en-1-amine;ethane (PubChem CID 163245894) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is (Z)-3-(2,6-dimethylcyclohexa-1,5-dien-1-yl)-3-ethyliminoprop-1-en-1-amine;ethane.
| Compound Name | (Z)-3-(2,6-dimethylcyclohexa-1,5-dien-1-yl)-3-ethyliminoprop-1-en-1-amine;ethane |
|---|---|
| PubChem CID | 163245894 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | (Z)-3-(2,6-dimethylcyclohexa-1,5-dien-1-yl)-3-ethyliminoprop-1-en-1-amine;ethane |
| SMILES | CC.CC/N=C(/C=C\N)C1=C(C)CCC=C1C |
| InChI | InChI=1S/C13H20N2.C2H6/c1-4-15-12(8-9-14)13-10(2)6-5-7-11(13)3;1-2/h6,8-9H,4-5,7,14H2,1-3H3;1-2H3/b9-8-,15-12-; |
| InChIKey | RGZDMXCXTZLUKZ-CSOFINOYSA-N |
| XLogP | 4.00 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|