C22H25N3O2S2 — CID 163270050
S-[7-oxo-7-([1,3]thiazolo[5,4-b]pyridin-2-ylamino)heptyl] 3-phenylpropanethioate (PubChem CID 163270050) has the molecular formula C22H25N3O2S2 and a molecular weight of 427.60 g/mol. Its IUPAC name is S-[7-oxo-7-([1,3]thiazolo[5,4-b]pyridin-2-ylamino)heptyl] 3-phenylpropanethioate.
| Compound Name | S-[7-oxo-7-([1,3]thiazolo[5,4-b]pyridin-2-ylamino)heptyl] 3-phenylpropanethioate |
|---|---|
| PubChem CID | 163270050 |
| Molecular Formula | C22H25N3O2S2 |
| Molecular Weight | 427.60 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | S-[7-oxo-7-([1,3]thiazolo[5,4-b]pyridin-2-ylamino)heptyl] 3-phenylpropanethioate |
| SMILES | O=C(CCCCCCSC(=O)CCc1ccccc1)Nc1nc2cccnc2s1 |
| InChI | InChI=1S/C22H25N3O2S2/c26-19(25-22-24-18-11-8-15-23-21(18)29-22)12-6-1-2-7-16-28-20(27)14-13-17-9-4-3-5-10-17/h3-5,8-11,15H,1-2,6-7,12-14,16H2,(H,24,25,26) |
| InChIKey | XRGGMJKPPPJBCQ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.60 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|