C16H22N3NaO8 — CID 163285496
sodium (3R,4S,5S,6R)-3,4,5-trihydroxy-6-[4-[methyl(nitroso)amino]-1-pyridin-3-ylbutoxy]oxane-2-carboxylate (PubChem CID 163285496) has the molecular formula C16H22N3NaO8 and a molecular weight of 407.36 g/mol. Its IUPAC name is sodium (3R,4S,5S,6R)-3,4,5-trihydroxy-6-[4-[methyl(nitroso)amino]-1-pyridin-3-ylbutoxy]oxane-2-carboxylate.
| Compound Name | sodium (3R,4S,5S,6R)-3,4,5-trihydroxy-6-[4-[methyl(nitroso)amino]-1-pyridin-3-ylbutoxy]oxane-2-carboxylate |
|---|---|
| PubChem CID | 163285496 |
| Molecular Formula | C16H22N3NaO8 |
| Molecular Weight | 407.36 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | sodium (3R,4S,5S,6R)-3,4,5-trihydroxy-6-[4-[methyl(nitroso)amino]-1-pyridin-3-ylbutoxy]oxane-2-carboxylate |
| SMILES | CN(CCCC(O[C@@H]1OC(C(=O)[O-])[C@H](O)[C@H](O)[C@@H]1O)c1cccnc1)N=O.[Na+] |
| InChI | InChI=1S/C16H23N3O8.Na/c1-19(18-25)7-3-5-10(9-4-2-6-17-8-9)26-16-13(22)11(20)12(21)14(27-16)15(23)24;/h2,4,6,8,10-14,16,20-22H,3,5,7H2,1H3,(H,23,24);/q;+1/p-1/t10?,11-,12+,13-,14?,16+;/m0./s1 |
| InChIKey | JBSOELKOANQAEZ-OHRTYUTQSA-M |
| XLogP | -4.91 |
| TPSA | 164.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.36 |
| LogP ≤ 5 | -4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|