C25H35N3O3 — CID 163308315
(1R,2S,8S,9S)-8-(cyclohexylmethyl)-11-(1-methyl-2-oxopyridine-4-carbonyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (PubChem CID 163308315) has the molecular formula C25H35N3O3 and a molecular weight of 425.57 g/mol. Its IUPAC name is (1R,2S,8S,9S)-8-(cyclohexylmethyl)-11-(1-methyl-2-oxopyridine-4-carbonyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one.
| Compound Name | (1R,2S,8S,9S)-8-(cyclohexylmethyl)-11-(1-methyl-2-oxopyridine-4-carbonyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
|---|---|
| PubChem CID | 163308315 |
| Molecular Formula | C25H35N3O3 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.27 |
| IUPAC Name | (1R,2S,8S,9S)-8-(cyclohexylmethyl)-11-(1-methyl-2-oxopyridine-4-carbonyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| SMILES | Cn1ccc(C(=O)N2C[C@H]3C[C@@H](C2)[C@H](CC2CCCCC2)N2C(=O)CCC[C@@H]32)cc1=O |
| InChI | InChI=1S/C25H35N3O3/c1-26-11-10-18(14-24(26)30)25(31)27-15-19-13-20(16-27)22(12-17-6-3-2-4-7-17)28-21(19)8-5-9-23(28)29/h10-11,14,17,19-22H,2-9,12-13,15-16H2,1H3/t19-,20+,21+,22+/m1/s1 |
| InChIKey | MGLXQQBBNRMOKK-MLNNCEHLSA-N |
| XLogP | 3.20 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |