C21H20Cl2N6OS — CID 163369010
N'-[5-[2-chloro-5-[(5-chloro-2-methoxy-3-pyridinyl)sulfanylamino]phenyl]-6-methyl-3-(methyliminomethyl)-2-pyridinyl]methanimidamide (PubChem CID 163369010) has the molecular formula C21H20Cl2N6OS and a molecular weight of 475.41 g/mol. Its IUPAC name is N'-[5-[2-chloro-5-[(5-chloro-2-methoxy-3-pyridinyl)sulfanylamino]phenyl]-6-methyl-3-(methyliminomethyl)-2-pyridinyl]methanimidamide.
| Compound Name | N'-[5-[2-chloro-5-[(5-chloro-2-methoxy-3-pyridinyl)sulfanylamino]phenyl]-6-methyl-3-(methyliminomethyl)-2-pyridinyl]methanimidamide |
|---|---|
| PubChem CID | 163369010 |
| Molecular Formula | C21H20Cl2N6OS |
| Molecular Weight | 475.41 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | N'-[5-[2-chloro-5-[(5-chloro-2-methoxy-3-pyridinyl)sulfanylamino]phenyl]-6-methyl-3-(methyliminomethyl)-2-pyridinyl]methanimidamide |
| SMILES | C/N=C/c1cc(-c2cc(NSc3cc(Cl)cnc3OC)ccc2Cl)c(C)nc1/N=C/N |
| InChI | InChI=1S/C21H20Cl2N6OS/c1-12-16(6-13(9-25-2)20(28-12)27-11-24)17-8-15(4-5-18(17)23)29-31-19-7-14(22)10-26-21(19)30-3/h4-11,29H,1-3H3,(H2,24,27,28)/b25-9+ |
| InChIKey | HNVIOAQGGRTAMS-YCPBAFNGSA-N |
| XLogP | 5.55 |
| TPSA | 97.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.41 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|