C28H36F3N5O5 — CID 163377122
tert-butyl N-[(9Z,12S)-6-hydroxy-6-(oxan-4-yl)-18-(trifluoromethyl)-22-oxa-3,4,16,21-tetrazatetracyclo[15.3.1.12,5.012,16]docosa-1(20),2,4,9,17(21),18-hexaen-20-yl]carbamate (PubChem CID 163377122) has the molecular formula C28H36F3N5O5 and a molecular weight of 579.62 g/mol. Its IUPAC name is tert-butyl N-[(9Z,12S)-6-hydroxy-6-(oxan-4-yl)-18-(trifluoromethyl)-22-oxa-3,4,16,21-tetrazatetracyclo[15.3.1.12,5.012,16]docosa-1(20),2,4,9,17(21),18-hexaen-20-yl]carbamate.
| Compound Name | tert-butyl N-[(9Z,12S)-6-hydroxy-6-(oxan-4-yl)-18-(trifluoromethyl)-22-oxa-3,4,16,21-tetrazatetracyclo[15.3.1.12,5.012,16]docosa-1(20),2,4,9,17(21),18-hexaen-20-yl]carbamate |
|---|---|
| PubChem CID | 163377122 |
| Molecular Formula | C28H36F3N5O5 |
| Molecular Weight | 579.62 g/mol |
| Exact Mass | 579.27 |
| IUPAC Name | tert-butyl N-[(9Z,12S)-6-hydroxy-6-(oxan-4-yl)-18-(trifluoromethyl)-22-oxa-3,4,16,21-tetrazatetracyclo[15.3.1.12,5.012,16]docosa-1(20),2,4,9,17(21),18-hexaen-20-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(C(F)(F)F)c2nc1-c1nnc(o1)C(O)(C1CCOCC1)CC/C=C\C[C@@H]1CCCN21 |
| InChI | InChI=1S/C28H36F3N5O5/c1-26(2,3)41-25(37)32-20-16-19(28(29,30)31)22-33-21(20)23-34-35-24(40-23)27(38,17-10-14-39-15-11-17)12-6-4-5-8-18-9-7-13-36(18)22/h4-5,16-18,38H,6-15H2,1-3H3,(H,32,37)/b5-4-/t18-,27?/m1/s1 |
| InChIKey | MFRHECSKTZCUJR-UFQGEJBNSA-N |
| XLogP | 5.82 |
| TPSA | 122.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.62 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|