C30H30N4 — CID 163414303
4-N-[4-(4-anilinoanilino)cyclohexa-1,5-dien-1-yl]-1-N-cyclohexa-2,4-dien-1-ylbenzene-1,4-diamine (PubChem CID 163414303) has the molecular formula C30H30N4 and a molecular weight of 446.60 g/mol. Its IUPAC name is 4-N-[4-(4-anilinoanilino)cyclohexa-1,5-dien-1-yl]-1-N-cyclohexa-2,4-dien-1-ylbenzene-1,4-diamine.
| Compound Name | 4-N-[4-(4-anilinoanilino)cyclohexa-1,5-dien-1-yl]-1-N-cyclohexa-2,4-dien-1-ylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 163414303 |
| Molecular Formula | C30H30N4 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | 4-N-[4-(4-anilinoanilino)cyclohexa-1,5-dien-1-yl]-1-N-cyclohexa-2,4-dien-1-ylbenzene-1,4-diamine |
| SMILES | C1=CCC(Nc2ccc(NC3=CCC(Nc4ccc(Nc5ccccc5)cc4)C=C3)cc2)C=C1 |
| InChI | InChI=1S/C30H30N4/c1-3-7-23(8-4-1)31-25-11-15-27(16-12-25)33-29-19-21-30(22-20-29)34-28-17-13-26(14-18-28)32-24-9-5-2-6-10-24/h1-9,11-19,21-22,24,29,31-34H,10,20H2 |
| InChIKey | ADBNXQVYHVOGBG-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'} |
|---|