C23H27FN5O7PS — CID 163416032
ethyl (2S)-2-[[[(2R,3R,4R,5S)-5-(4-aminothieno[3,2-d]pyrimidin-7-yl)-4-fluoro-3-hydroxy-2-(methylideneamino)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 163416032) has the molecular formula C23H27FN5O7PS and a molecular weight of 567.54 g/mol. Its IUPAC name is ethyl (2S)-2-[[[(2R,3R,4R,5S)-5-(4-aminothieno[3,2-d]pyrimidin-7-yl)-4-fluoro-3-hydroxy-2-(methylideneamino)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[[(2R,3R,4R,5S)-5-(4-aminothieno[3,2-d]pyrimidin-7-yl)-4-fluoro-3-hydroxy-2-(methylideneamino)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 163416032 |
| Molecular Formula | C23H27FN5O7PS |
| Molecular Weight | 567.54 g/mol |
| Exact Mass | 567.14 |
| IUPAC Name | ethyl (2S)-2-[[[(2R,3R,4R,5S)-5-(4-aminothieno[3,2-d]pyrimidin-7-yl)-4-fluoro-3-hydroxy-2-(methylideneamino)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C=N[C@]1(COP(=O)(N[C@@H](C)C(=O)OCC)Oc2ccccc2)O[C@@H](c2csc3c(N)ncnc23)[C@H](F)[C@@H]1O |
| InChI | InChI=1S/C23H27FN5O7PS/c1-4-33-22(31)13(2)29-37(32,36-14-8-6-5-7-9-14)34-11-23(26-3)20(30)16(24)18(35-23)15-10-38-19-17(15)27-12-28-21(19)25/h5-10,12-13,16,18,20,30H,3-4,11H2,1-2H3,(H,29,32)(H2,25,27,28)/t13-,16-,18-,20-,23+,37?/m0/s1 |
| InChIKey | AEMQYFUEEIUFAF-KTPQNGOPSA-N |
| XLogP | 3.19 |
| TPSA | 167.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.54 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|