About N'-ethyl-N-methyl-N,N'-dioxidomethanediamine
N'-ethyl-N-methyl-N,N'-dioxidomethanediamine (PubChem CID 163436246) has the molecular formula C4H10N2O2-2
and a molecular weight of 118.14 g/mol. Its IUPAC name is N'-ethyl-N-methyl-N,N'-dioxidomethanediamine.
Molecular Properties
| Compound Name | N'-ethyl-N-methyl-N,N'-dioxidomethanediamine |
| PubChem CID | 163436246 |
| Molecular Formula | C4H10N2O2-2 |
| Molecular Weight | 118.14 g/mol |
| Exact Mass | 118.08 |
| IUPAC Name | N'-ethyl-N-methyl-N,N'-dioxidomethanediamine |
| SMILES | CCN([O-])CN(C)[O-] |
| InChI | InChI=1S/C4H10N2O2/c1-3-6(8)4-5(2)7/h3-4H2,1-2H3/q-2 |
| InChIKey | WTHAUZFEDPUUSB-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.14 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-ethyl-N-methyl-N,N'-dioxidomethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethyl-N-methyl-N,N'-dioxidomethanediamine?
The IUPAC name of N'-ethyl-N-methyl-N,N'-dioxidomethanediamine (CID 163436246) is N'-ethyl-N-methyl-N,N'-dioxidomethanediamine.
What is the SMILES notation for N'-ethyl-N-methyl-N,N'-dioxidomethanediamine?
The canonical SMILES for N'-ethyl-N-methyl-N,N'-dioxidomethanediamine is CCN([O-])CN(C)[O-].
What is the InChIKey of N'-ethyl-N-methyl-N,N'-dioxidomethanediamine?
The InChIKey is WTHAUZFEDPUUSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2O2/c1-3-6(8)4-5(2)7/h3-4H2,1-2H3/q-2.
What are the key properties of N'-ethyl-N-methyl-N,N'-dioxidomethanediamine?
N'-ethyl-N-methyl-N,N'-dioxidomethanediamine has a molecular weight of 118.14 g/mol, XLogP of 0.19, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethyl-N-methyl-N,N'-dioxidomethanediamine is sourced from PubChem (CID 163436246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).