C18H25O+ — CID 163474888
[(1S,9R,10R)-17-methyl-4-tetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trienyl]oxidanium (PubChem CID 163474888) has the molecular formula C18H25O+ and a molecular weight of 257.40 g/mol. Its IUPAC name is [(1S,9R,10R)-17-methyl-4-tetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trienyl]oxidanium.
| Compound Name | [(1S,9R,10R)-17-methyl-4-tetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trienyl]oxidanium |
|---|---|
| PubChem CID | 163474888 |
| Molecular Formula | C18H25O+ |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | [(1S,9R,10R)-17-methyl-4-tetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trienyl]oxidanium |
| SMILES | CC1CC[C@@]23CCCC[C@@H]2[C@@H]1Cc1ccc([OH2+])cc13 |
| InChI | InChI=1S/C18H24O/c1-12-7-9-18-8-3-2-4-16(18)15(12)10-13-5-6-14(19)11-17(13)18/h5-6,11-12,15-16,19H,2-4,7-10H2,1H3/p+1/t12?,15-,16-,18+/m1/s1 |
| InChIKey | BZQACZCZFDRSSF-BPOXDMDKSA-O |
| XLogP | 4.15 |
| TPSA | 22.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|