C10H16F3N3 — CID 163510304
(2Z)-2-(1-hydrazinylpropyl)-N-(2,2,2-trifluoroethyl)penta-2,4-dien-1-imine (PubChem CID 163510304) has the molecular formula C10H16F3N3 and a molecular weight of 235.25 g/mol. Its IUPAC name is (2Z)-2-(1-hydrazinylpropyl)-N-(2,2,2-trifluoroethyl)penta-2,4-dien-1-imine.
| Compound Name | (2Z)-2-(1-hydrazinylpropyl)-N-(2,2,2-trifluoroethyl)penta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 163510304 |
| Molecular Formula | C10H16F3N3 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | (2Z)-2-(1-hydrazinylpropyl)-N-(2,2,2-trifluoroethyl)penta-2,4-dien-1-imine |
| SMILES | C=C/C=C(\C=N\CC(F)(F)F)C(CC)NN |
| InChI | InChI=1S/C10H16F3N3/c1-3-5-8(9(4-2)16-14)6-15-7-10(11,12)13/h3,5-6,9,16H,1,4,7,14H2,2H3/b8-5+,15-6+ |
| InChIKey | DCDLGRBQOZYHMH-NVWKQHGVSA-N |
| XLogP | 1.97 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|