C40H47N7O6 — CID 163522401
5-O-[2-[4-[[2,5-dimethoxy-4-[(4-phenyldiazenylphenyl)diazenyl]phenyl]diazenyl]-N-ethylanilino]ethyl] 1-O-methyl 2-ethyl-2,4-dimethylpentanedioate (PubChem CID 163522401) has the molecular formula C40H47N7O6 and a molecular weight of 721.86 g/mol. Its IUPAC name is 5-O-[2-[4-[[2,5-dimethoxy-4-[(4-phenyldiazenylphenyl)diazenyl]phenyl]diazenyl]-N-ethylanilino]ethyl] 1-O-methyl 2-ethyl-2,4-dimethylpentanedioate.
| Compound Name | 5-O-[2-[4-[[2,5-dimethoxy-4-[(4-phenyldiazenylphenyl)diazenyl]phenyl]diazenyl]-N-ethylanilino]ethyl] 1-O-methyl 2-ethyl-2,4-dimethylpentanedioate |
|---|---|
| PubChem CID | 163522401 |
| Molecular Formula | C40H47N7O6 |
| Molecular Weight | 721.86 g/mol |
| Exact Mass | 721.36 |
| IUPAC Name | 5-O-[2-[4-[[2,5-dimethoxy-4-[(4-phenyldiazenylphenyl)diazenyl]phenyl]diazenyl]-N-ethylanilino]ethyl] 1-O-methyl 2-ethyl-2,4-dimethylpentanedioate |
| SMILES | CCN(CCOC(=O)C(C)CC(C)(CC)C(=O)OC)c1ccc(/N=N/c2cc(OC)c(/N=N/c3ccc(/N=N/c4ccccc4)cc3)cc2OC)cc1 |
| InChI | InChI=1S/C40H47N7O6/c1-8-40(4,39(49)52-7)27-28(3)38(48)53-24-23-47(9-2)33-21-19-32(20-22-33)44-46-35-26-36(50-5)34(25-37(35)51-6)45-43-31-17-15-30(16-18-31)42-41-29-13-11-10-12-14-29/h10-22,25-26,28H,8-9,23-24,27H2,1-7H3/b42-41+,45-43+,46-44+ |
| InChIKey | DLYMNIJYKRUTKI-WHFTWJTLSA-N |
| XLogP | 10.94 |
| TPSA | 148.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.86 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|