C8H15BNO- — CID 163533265
(4,5-dimethyl-1-oxidopiperidin-2-yl)-methylideneborane (PubChem CID 163533265) has the molecular formula C8H15BNO- and a molecular weight of 152.03 g/mol. Its IUPAC name is (4,5-dimethyl-1-oxidopiperidin-2-yl)-methylideneborane.
| Compound Name | (4,5-dimethyl-1-oxidopiperidin-2-yl)-methylideneborane |
|---|---|
| PubChem CID | 163533265 |
| Molecular Formula | C8H15BNO- |
| Molecular Weight | 152.03 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | (4,5-dimethyl-1-oxidopiperidin-2-yl)-methylideneborane |
| SMILES | C=BC1CC(C)C(C)CN1[O-] |
| InChI | InChI=1S/C8H15BNO/c1-6-4-8(9-3)10(11)5-7(6)2/h6-8H,3-5H2,1-2H3/q-1 |
| InChIKey | GHBXIJVRWCKVNF-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.03 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|