C13H27N3O3 — CID 163551181
(2S,5R)-5-(butoxyamino)-N-propoxypiperidine-2-carboxamide (PubChem CID 163551181) has the molecular formula C13H27N3O3 and a molecular weight of 273.38 g/mol. Its IUPAC name is (2S,5R)-5-(butoxyamino)-N-propoxypiperidine-2-carboxamide.
| Compound Name | (2S,5R)-5-(butoxyamino)-N-propoxypiperidine-2-carboxamide |
|---|---|
| PubChem CID | 163551181 |
| Molecular Formula | C13H27N3O3 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | (2S,5R)-5-(butoxyamino)-N-propoxypiperidine-2-carboxamide |
| SMILES | CCCCON[C@@H]1CC[C@@H](C(=O)NOCCC)NC1 |
| InChI | InChI=1S/C13H27N3O3/c1-3-5-9-19-15-11-6-7-12(14-10-11)13(17)16-18-8-4-2/h11-12,14-15H,3-10H2,1-2H3,(H,16,17)/t11-,12+/m1/s1 |
| InChIKey | NJEYWKMDTNJKAJ-NEPJUHHUSA-N |
| XLogP | 0.89 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|