C18H13NO4S — CID 163552635
carbon dioxide;5-(3-phenyl-2-sulfanylidenepropyl)isoindole-1,3-dione (PubChem CID 163552635) has the molecular formula C18H13NO4S and a molecular weight of 339.37 g/mol. Its IUPAC name is carbon dioxide;5-(3-phenyl-2-sulfanylidenepropyl)isoindole-1,3-dione.
| Compound Name | carbon dioxide;5-(3-phenyl-2-sulfanylidenepropyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 163552635 |
| Molecular Formula | C18H13NO4S |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | carbon dioxide;5-(3-phenyl-2-sulfanylidenepropyl)isoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2cc(CC(=S)Cc3ccccc3)ccc21.O=C=O |
| InChI | InChI=1S/C17H13NO2S.CO2/c19-16-14-7-6-12(10-15(14)17(20)18-16)9-13(21)8-11-4-2-1-3-5-11;2-1-3/h1-7,10H,8-9H2,(H,18,19,20); |
| InChIKey | FKIHEOOSJUTTOL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|