C13H20O2 — CID 163570445
5-methyl-2-[(3E,5Z)-octa-1,3,5-trien-4-yl]-1,3-dioxane (PubChem CID 163570445) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 5-methyl-2-[(3E,5Z)-octa-1,3,5-trien-4-yl]-1,3-dioxane.
| Compound Name | 5-methyl-2-[(3E,5Z)-octa-1,3,5-trien-4-yl]-1,3-dioxane |
|---|---|
| PubChem CID | 163570445 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 5-methyl-2-[(3E,5Z)-octa-1,3,5-trien-4-yl]-1,3-dioxane |
| SMILES | C=C/C=C(\C=C/CC)C1OCC(C)CO1 |
| InChI | InChI=1S/C13H20O2/c1-4-6-8-12(7-5-2)13-14-9-11(3)10-15-13/h5-8,11,13H,2,4,9-10H2,1,3H3/b8-6-,12-7+ |
| InChIKey | FYWRGLKYJUOGKO-LQNKLOEDSA-N |
| XLogP | 3.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|