C37H38N2O4 — CID 163574631
(4'S,5R,6'S)-3-[(4-ethylphenyl)methyl]-4'-phenylmethoxy-6'-(phenylmethoxymethyl)spiro[2,7-dihydrofuro[3,4-f]indazole-5,2'-oxane] (PubChem CID 163574631) has the molecular formula C37H38N2O4 and a molecular weight of 574.72 g/mol. Its IUPAC name is (4'S,5R,6'S)-3-[(4-ethylphenyl)methyl]-4'-phenylmethoxy-6'-(phenylmethoxymethyl)spiro[2,7-dihydrofuro[3,4-f]indazole-5,2'-oxane].
| Compound Name | (4'S,5R,6'S)-3-[(4-ethylphenyl)methyl]-4'-phenylmethoxy-6'-(phenylmethoxymethyl)spiro[2,7-dihydrofuro[3,4-f]indazole-5,2'-oxane] |
|---|---|
| PubChem CID | 163574631 |
| Molecular Formula | C37H38N2O4 |
| Molecular Weight | 574.72 g/mol |
| Exact Mass | 574.28 |
| IUPAC Name | (4'S,5R,6'S)-3-[(4-ethylphenyl)methyl]-4'-phenylmethoxy-6'-(phenylmethoxymethyl)spiro[2,7-dihydrofuro[3,4-f]indazole-5,2'-oxane] |
| SMILES | CCc1ccc(Cc2[nH]nc3cc4c(cc23)[C@]2(C[C@@H](OCc3ccccc3)C[C@@H](COCc3ccccc3)O2)OC4)cc1 |
| InChI | InChI=1S/C37H38N2O4/c1-2-26-13-15-27(16-14-26)17-35-33-20-34-30(18-36(33)39-38-35)24-42-37(34)21-31(41-23-29-11-7-4-8-12-29)19-32(43-37)25-40-22-28-9-5-3-6-10-28/h3-16,18,20,31-32H,2,17,19,21-25H2,1H3,(H,38,39)/t31-,32-,37+/m0/s1 |
| InChIKey | GCJOJSFBDKOVIM-OGLWZABDSA-N |
| XLogP | 7.38 |
| TPSA | 65.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.72 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |