C23H23N5O7P+ — CID 163588431
[(E)-[(3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-4-hydroxy-4-methyl-3-(2-methylpropanoyloxy)oxolan-2-ylidene]methoxy]-oxo-phenoxyphosphanium (PubChem CID 163588431) has the molecular formula C23H23N5O7P+ and a molecular weight of 512.44 g/mol. Its IUPAC name is [(E)-[(3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-4-hydroxy-4-methyl-3-(2-methylpropanoyloxy)oxolan-2-ylidene]methoxy]-oxo-phenoxyphosphanium.
| Compound Name | [(E)-[(3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-4-hydroxy-4-methyl-3-(2-methylpropanoyloxy)oxolan-2-ylidene]methoxy]-oxo-phenoxyphosphanium |
|---|---|
| PubChem CID | 163588431 |
| Molecular Formula | C23H23N5O7P+ |
| Molecular Weight | 512.44 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | [(E)-[(3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-4-hydroxy-4-methyl-3-(2-methylpropanoyloxy)oxolan-2-ylidene]methoxy]-oxo-phenoxyphosphanium |
| SMILES | CC(C)C(=O)O[C@@H]1/C(=C\O[P+](=O)Oc2ccccc2)O[C@@](C#N)(c2ccc3c(N)ncnn23)[C@]1(C)O |
| InChI | InChI=1S/C23H23N5O7P/c1-14(2)21(29)33-19-17(11-32-36(31)35-15-7-5-4-6-8-15)34-23(12-24,22(19,3)30)18-10-9-16-20(25)26-13-27-28(16)18/h4-11,13-14,19,30H,1-3H3,(H2,25,26,27)/q+1/b17-11+/t19-,22-,23+/m1/s1 |
| InChIKey | GNLSOFXMUXNNEY-YIRZMBLISA-N |
| XLogP | 2.97 |
| TPSA | 171.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|