C26H23N5O6 — CID 163646996
[(2R,3R,5R)-5-(4-benzamidopyrrolo[2,3-d]pyrimidin-7-yl)-2-ethyloxolan-3-yl] 4-nitrobenzoate (PubChem CID 163646996) has the molecular formula C26H23N5O6 and a molecular weight of 501.50 g/mol. Its IUPAC name is [(2R,3R,5R)-5-(4-benzamidopyrrolo[2,3-d]pyrimidin-7-yl)-2-ethyloxolan-3-yl] 4-nitrobenzoate.
| Compound Name | [(2R,3R,5R)-5-(4-benzamidopyrrolo[2,3-d]pyrimidin-7-yl)-2-ethyloxolan-3-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 163646996 |
| Molecular Formula | C26H23N5O6 |
| Molecular Weight | 501.50 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | [(2R,3R,5R)-5-(4-benzamidopyrrolo[2,3-d]pyrimidin-7-yl)-2-ethyloxolan-3-yl] 4-nitrobenzoate |
| SMILES | CC[C@H]1O[C@@H](n2ccc3c(NC(=O)c4ccccc4)ncnc32)C[C@H]1OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H23N5O6/c1-2-20-21(37-26(33)17-8-10-18(11-9-17)31(34)35)14-22(36-20)30-13-12-19-23(27-15-28-24(19)30)29-25(32)16-6-4-3-5-7-16/h3-13,15,20-22H,2,14H2,1H3,(H,27,28,29,32)/t20-,21-,22-/m1/s1 |
| InChIKey | BEGVCNBDBKJMPK-YPAWHYETSA-N |
| XLogP | 4.51 |
| TPSA | 138.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|