C15H19N — CID 163655826
2-methyl-2-(6-tricyclo[5.4.0.02,11]undeca-3,5,7-trienyl)propan-1-imine (PubChem CID 163655826) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is 2-methyl-2-(6-tricyclo[5.4.0.02,11]undeca-3,5,7-trienyl)propan-1-imine.
| Compound Name | 2-methyl-2-(6-tricyclo[5.4.0.02,11]undeca-3,5,7-trienyl)propan-1-imine |
|---|---|
| PubChem CID | 163655826 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 2-methyl-2-(6-tricyclo[5.4.0.02,11]undeca-3,5,7-trienyl)propan-1-imine |
| SMILES | [H]/N=C/C(C)(C)C1=CC=CC2C3CCC=C1C23 |
| InChI | InChI=1S/C15H19N/c1-15(2,9-16)13-8-4-6-11-10-5-3-7-12(13)14(10)11/h4,6-11,14,16H,3,5H2,1-2H3/b16-9+ |
| InChIKey | IQCQQXAFDMKDMA-CXUHLZMHSA-N |
| XLogP | 3.74 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|