C22H32 — CID 163663337
1-[(4R,5R)-5-[(Z)-hept-4-en-2-yl]-4-methylcyclohexen-1-yl]ethylbenzene (PubChem CID 163663337) has the molecular formula C22H32 and a molecular weight of 296.50 g/mol. Its IUPAC name is 1-[(4R,5R)-5-[(Z)-hept-4-en-2-yl]-4-methylcyclohexen-1-yl]ethylbenzene.
| Compound Name | 1-[(4R,5R)-5-[(Z)-hept-4-en-2-yl]-4-methylcyclohexen-1-yl]ethylbenzene |
|---|---|
| PubChem CID | 163663337 |
| Molecular Formula | C22H32 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | 1-[(4R,5R)-5-[(Z)-hept-4-en-2-yl]-4-methylcyclohexen-1-yl]ethylbenzene |
| SMILES | CC/C=C\CC(C)[C@H]1CC(C(C)c2ccccc2)=CC[C@H]1C |
| InChI | InChI=1S/C22H32/c1-5-6-8-11-17(2)22-16-21(15-14-18(22)3)19(4)20-12-9-7-10-13-20/h6-10,12-13,15,17-19,22H,5,11,14,16H2,1-4H3/b8-6-/t17?,18-,19?,22-/m1/s1 |
| InChIKey | IWGMRHMJIHJDDK-WBDLSNQQSA-N |
| XLogP | 6.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|