C21H18Cl4O — CID 163680618
(2E,6E)-2-[(2,6-dichloro-4-methylcyclohexa-1,5-dien-1-yl)methylidene]-6-[(2,6-dichlorophenyl)methylidene]cyclohexan-1-one (PubChem CID 163680618) has the molecular formula C21H18Cl4O and a molecular weight of 428.19 g/mol. Its IUPAC name is (2E,6E)-2-[(2,6-dichloro-4-methylcyclohexa-1,5-dien-1-yl)methylidene]-6-[(2,6-dichlorophenyl)methylidene]cyclohexan-1-one.
| Compound Name | (2E,6E)-2-[(2,6-dichloro-4-methylcyclohexa-1,5-dien-1-yl)methylidene]-6-[(2,6-dichlorophenyl)methylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 163680618 |
| Molecular Formula | C21H18Cl4O |
| Molecular Weight | 428.19 g/mol |
| Exact Mass | 426.01 |
| IUPAC Name | (2E,6E)-2-[(2,6-dichloro-4-methylcyclohexa-1,5-dien-1-yl)methylidene]-6-[(2,6-dichlorophenyl)methylidene]cyclohexan-1-one |
| SMILES | CC1C=C(Cl)C(/C=C2\CCC/C(=C\c3c(Cl)cccc3Cl)C2=O)=C(Cl)C1 |
| InChI | InChI=1S/C21H18Cl4O/c1-12-8-19(24)16(20(25)9-12)11-14-5-2-4-13(21(14)26)10-15-17(22)6-3-7-18(15)23/h3,6-8,10-12H,2,4-5,9H2,1H3/b13-10+,14-11+ |
| InChIKey | JKMTVZCWIKDNRB-IFQMDVHZSA-N |
| XLogP | 7.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.19 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|