C20H14Cl2F2O — CID 5143813
2,6-bis[(2-chloro-6-fluorophenyl)methylidene]cyclohexan-1-one (PubChem CID 5143813) has the molecular formula C20H14Cl2F2O and a molecular weight of 379.23 g/mol. Its IUPAC name is 2,6-bis[(2-chloro-6-fluorophenyl)methylidene]cyclohexan-1-one.
| Compound Name | 2,6-bis[(2-chloro-6-fluorophenyl)methylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 5143813 |
| Molecular Formula | C20H14Cl2F2O |
| Molecular Weight | 379.23 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | 2,6-bis[(2-chloro-6-fluorophenyl)methylidene]cyclohexan-1-one |
| SMILES | O=C1C(=Cc2c(F)cccc2Cl)CCCC1=Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C20H14Cl2F2O/c21-16-6-2-8-18(23)14(16)10-12-4-1-5-13(20(12)25)11-15-17(22)7-3-9-19(15)24/h2-3,6-11H,1,4-5H2 |
| InChIKey | WDCXAVZLNFAYRK-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.23 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|