C14H10N4 — CID 163691592
5,9,14,18-tetrazapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaene (PubChem CID 163691592) has the molecular formula C14H10N4 and a molecular weight of 234.26 g/mol. Its IUPAC name is 5,9,14,18-tetrazapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaene.
| Compound Name | 5,9,14,18-tetrazapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaene |
|---|---|
| PubChem CID | 163691592 |
| Molecular Formula | C14H10N4 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 5,9,14,18-tetrazapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaene |
| SMILES | c1cc2[nH]c3cc4c(cc3c2[nH]1)[nH]c1cc[nH]c14 |
| InChI | InChI=1S/C14H10N4/c1-3-15-13-7-5-12-8(6-11(7)17-9(1)13)14-10(18-12)2-4-16-14/h1-6,15-18H |
| InChIKey | JTKQUPODJVIWKP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |