C35H27NO — CID 163697642
4-[N-(2,2-diphenylethenyl)-4-[(E)-2-phenylethenyl]anilino]benzaldehyde (PubChem CID 163697642) has the molecular formula C35H27NO and a molecular weight of 477.61 g/mol. Its IUPAC name is 4-[N-(2,2-diphenylethenyl)-4-[(E)-2-phenylethenyl]anilino]benzaldehyde.
| Compound Name | 4-[N-(2,2-diphenylethenyl)-4-[(E)-2-phenylethenyl]anilino]benzaldehyde |
|---|---|
| PubChem CID | 163697642 |
| Molecular Formula | C35H27NO |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | 4-[N-(2,2-diphenylethenyl)-4-[(E)-2-phenylethenyl]anilino]benzaldehyde |
| SMILES | O=Cc1ccc(N(C=C(c2ccccc2)c2ccccc2)c2ccc(/C=C/c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C35H27NO/c37-27-30-20-24-34(25-21-30)36(26-35(31-12-6-2-7-13-31)32-14-8-3-9-15-32)33-22-18-29(19-23-33)17-16-28-10-4-1-5-11-28/h1-27H/b17-16+ |
| InChIKey | JYGRUXHGSJGRHC-WUKNDPDISA-N |
| XLogP | 8.90 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hzone_phenone(7)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|