C21H48N2OPU- — CID 163701376
2,2-dimethyl-1-(2-methylpropoxy)propane;N-[di(propan-2-yl)amino]phosphanyl-N-propan-2-ylpropan-2-amine;uranium (PubChem CID 163701376) has the molecular formula C21H48N2OPU- and a molecular weight of 613.63 g/mol. Its IUPAC name is 2,2-dimethyl-1-(2-methylpropoxy)propane;N-[di(propan-2-yl)amino]phosphanyl-N-propan-2-ylpropan-2-amine;uranium.
| Compound Name | 2,2-dimethyl-1-(2-methylpropoxy)propane;N-[di(propan-2-yl)amino]phosphanyl-N-propan-2-ylpropan-2-amine;uranium |
|---|---|
| PubChem CID | 163701376 |
| Molecular Formula | C21H48N2OPU- |
| Molecular Weight | 613.63 g/mol |
| Exact Mass | 613.40 |
| IUPAC Name | 2,2-dimethyl-1-(2-methylpropoxy)propane;N-[di(propan-2-yl)amino]phosphanyl-N-propan-2-ylpropan-2-amine;uranium |
| SMILES | CC(C)N(PN(C(C)C)C(C)C)C(C)C.C[C-](C)COCC(C)(C)C.[U] |
| InChI | InChI=1S/C12H29N2P.C9H19O.U/c1-9(2)13(10(3)4)15-14(11(5)6)12(7)8;1-8(2)6-10-7-9(3,4)5;/h9-12,15H,1-8H3;6-7H2,1-5H3;/q;-1; |
| InChIKey | KVASJSAKMQIAFY-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.63 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|