C9H14O — CID 163713912
(3aR,4R,6R,6aR)-4,6-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]furan (PubChem CID 163713912) has the molecular formula C9H14O and a molecular weight of 138.21 g/mol. Its IUPAC name is (3aR,4R,6R,6aR)-4,6-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]furan.
| Compound Name | (3aR,4R,6R,6aR)-4,6-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]furan |
|---|---|
| PubChem CID | 163713912 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | (3aR,4R,6R,6aR)-4,6-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]furan |
| SMILES | C[C@@H]1C[C@@H](C)[C@H]2OC=C[C@H]21 |
| InChI | InChI=1S/C9H14O/c1-6-5-7(2)9-8(6)3-4-10-9/h3-4,6-9H,5H2,1-2H3/t6-,7-,8+,9-/m1/s1 |
| InChIKey | SZRXLCMANDCLLR-LURQLKTLSA-N |
| XLogP | 2.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |