C22H22OS2 — CID 163718013
3-[(Z)-3-[[(Z)-2-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)ethenyl]sulfanylmethoxysulfanyl]prop-1-enyl]bicyclo[4.2.0]octa-1(6),2,4-triene (PubChem CID 163718013) has the molecular formula C22H22OS2 and a molecular weight of 366.55 g/mol. Its IUPAC name is 3-[(Z)-3-[[(Z)-2-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)ethenyl]sulfanylmethoxysulfanyl]prop-1-enyl]bicyclo[4.2.0]octa-1(6),2,4-triene.
| Compound Name | 3-[(Z)-3-[[(Z)-2-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)ethenyl]sulfanylmethoxysulfanyl]prop-1-enyl]bicyclo[4.2.0]octa-1(6),2,4-triene |
|---|---|
| PubChem CID | 163718013 |
| Molecular Formula | C22H22OS2 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 3-[(Z)-3-[[(Z)-2-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)ethenyl]sulfanylmethoxysulfanyl]prop-1-enyl]bicyclo[4.2.0]octa-1(6),2,4-triene |
| SMILES | C(=C\c1ccc2c(c1)CC2)\CSOCS/C=C\c1ccc2c(c1)CC2 |
| InChI | InChI=1S/C22H22OS2/c1(2-17-3-5-19-7-9-21(19)14-17)12-25-23-16-24-13-11-18-4-6-20-8-10-22(20)15-18/h1-6,11,13-15H,7-10,12,16H2/b2-1-,13-11- |
| InChIKey | KPBAHHRDQWSTFV-SZMJDQHKSA-N |
| XLogP | 5.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|