C13H22F2O — CID 163744956
(3R,4S)-6-(1,1-difluoroethoxy)-4-methyl-3-(2-methylpropyl)cyclohexene (PubChem CID 163744956) has the molecular formula C13H22F2O and a molecular weight of 232.31 g/mol. Its IUPAC name is (3R,4S)-6-(1,1-difluoroethoxy)-4-methyl-3-(2-methylpropyl)cyclohexene.
| Compound Name | (3R,4S)-6-(1,1-difluoroethoxy)-4-methyl-3-(2-methylpropyl)cyclohexene |
|---|---|
| PubChem CID | 163744956 |
| Molecular Formula | C13H22F2O |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | (3R,4S)-6-(1,1-difluoroethoxy)-4-methyl-3-(2-methylpropyl)cyclohexene |
| SMILES | CC(C)C[C@H]1C=CC(OC(C)(F)F)C[C@@H]1C |
| InChI | InChI=1S/C13H22F2O/c1-9(2)7-11-5-6-12(8-10(11)3)16-13(4,14)15/h5-6,9-12H,7-8H2,1-4H3/t10-,11+,12?/m0/s1 |
| InChIKey | LLAJTHOYUQPVJA-WIKAKEFZSA-N |
| XLogP | 4.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|