C9H11N2O4PS — CID 163762602
4-(2-phosphanylideneethylcarbamoylamino)benzenesulfonic acid (PubChem CID 163762602) has the molecular formula C9H11N2O4PS and a molecular weight of 274.24 g/mol. Its IUPAC name is 4-(2-phosphanylideneethylcarbamoylamino)benzenesulfonic acid.
| Compound Name | 4-(2-phosphanylideneethylcarbamoylamino)benzenesulfonic acid |
|---|---|
| PubChem CID | 163762602 |
| Molecular Formula | C9H11N2O4PS |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 4-(2-phosphanylideneethylcarbamoylamino)benzenesulfonic acid |
| SMILES | [H]/P=C/CNC(=O)Nc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C9H11N2O4PS/c12-9(10-5-6-16)11-7-1-3-8(4-2-7)17(13,14)15/h1-4,6,16H,5H2,(H2,10,11,12)(H,13,14,15) |
| InChIKey | LZMGRJHPFWLSFN-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|