C7H12N2O — CID 163770567
4,6,6-trimethyl-1,4-diazabicyclo[3.1.0]hexan-2-one (PubChem CID 163770567) has the molecular formula C7H12N2O and a molecular weight of 140.19 g/mol. Its IUPAC name is 4,6,6-trimethyl-1,4-diazabicyclo[3.1.0]hexan-2-one.
| Compound Name | 4,6,6-trimethyl-1,4-diazabicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 163770567 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 4,6,6-trimethyl-1,4-diazabicyclo[3.1.0]hexan-2-one |
| SMILES | CN1CC(=O)N2C1C2(C)C |
| InChI | InChI=1S/C7H12N2O/c1-7(2)6-8(3)4-5(10)9(6)7/h6H,4H2,1-3H3 |
| InChIKey | MGAXZTUHBARYLC-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 23.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|