C17H36N4+4 — CID 163794993
3-(2-azaniumylethyl)hexa-1,3,5-trienyl-[3-(1,4-dimethylpiperazine-1,4-diium-1-yl)propyl]azanium (PubChem CID 163794993) has the molecular formula C17H36N4+4 and a molecular weight of 296.50 g/mol. Its IUPAC name is 3-(2-azaniumylethyl)hexa-1,3,5-trienyl-[3-(1,4-dimethylpiperazine-1,4-diium-1-yl)propyl]azanium.
| Compound Name | 3-(2-azaniumylethyl)hexa-1,3,5-trienyl-[3-(1,4-dimethylpiperazine-1,4-diium-1-yl)propyl]azanium |
|---|---|
| PubChem CID | 163794993 |
| Molecular Formula | C17H36N4+4 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.29 |
| IUPAC Name | 3-(2-azaniumylethyl)hexa-1,3,5-trienyl-[3-(1,4-dimethylpiperazine-1,4-diium-1-yl)propyl]azanium |
| SMILES | C=CC=C(C=C[NH2+]CCC[N+]1(C)CC[NH+](C)CC1)CC[NH3+] |
| InChI | InChI=1S/C17H33N4/c1-4-6-17(7-9-18)8-11-19-10-5-14-21(3)15-12-20(2)13-16-21/h4,6,8,11,19H,1,5,7,9-10,12-16,18H2,2-3H3/q+1/p+3 |
| InChIKey | JDWOXDIKIOZCDV-UHFFFAOYSA-Q |
| XLogP | -1.83 |
| TPSA | 48.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|