C20H28N4 — CID 89231415
1-N-[(5Z,6E)-3-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]-5-(aminomethylidene)-6-prop-2-enylidenecyclohexa-1,3-dien-1-yl]-2-methylpropane-1,2-diamine (PubChem CID 89231415) has the molecular formula C20H28N4 and a molecular weight of 324.47 g/mol. Its IUPAC name is 1-N-[(5Z,6E)-3-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]-5-(aminomethylidene)-6-prop-2-enylidenecyclohexa-1,3-dien-1-yl]-2-methylpropane-1,2-diamine.
| Compound Name | 1-N-[(5Z,6E)-3-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]-5-(aminomethylidene)-6-prop-2-enylidenecyclohexa-1,3-dien-1-yl]-2-methylpropane-1,2-diamine |
|---|---|
| PubChem CID | 89231415 |
| Molecular Formula | C20H28N4 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | 1-N-[(5Z,6E)-3-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]-5-(aminomethylidene)-6-prop-2-enylidenecyclohexa-1,3-dien-1-yl]-2-methylpropane-1,2-diamine |
| SMILES | C=C/C=C(\C=C/N)c1cc(NCC(C)(C)N)c(=C/C=C)/c(=C\N)c1 |
| InChI | InChI=1S/C20H28N4/c1-5-7-15(9-10-21)16-11-17(13-22)18(8-6-2)19(12-16)24-14-20(3,4)23/h5-13,24H,1-2,14,21-23H2,3-4H3/b10-9-,15-7+,17-13-,18-8+ |
| InChIKey | GALIUFHDIWNPCS-GFYYHWBWSA-N |
| XLogP | 1.54 |
| TPSA | 90.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|