C28H35NO4 — CID 163817015
(2-methyl-2-adamantyl) 2-[4-(1-oxidopiperidin-1-ium-1-yl)naphthalen-1-yl]oxyacetate (PubChem CID 163817015) has the molecular formula C28H35NO4 and a molecular weight of 449.59 g/mol. Its IUPAC name is (2-methyl-2-adamantyl) 2-[4-(1-oxidopiperidin-1-ium-1-yl)naphthalen-1-yl]oxyacetate.
| Compound Name | (2-methyl-2-adamantyl) 2-[4-(1-oxidopiperidin-1-ium-1-yl)naphthalen-1-yl]oxyacetate |
|---|---|
| PubChem CID | 163817015 |
| Molecular Formula | C28H35NO4 |
| Molecular Weight | 449.59 g/mol |
| Exact Mass | 449.26 |
| IUPAC Name | (2-methyl-2-adamantyl) 2-[4-(1-oxidopiperidin-1-ium-1-yl)naphthalen-1-yl]oxyacetate |
| SMILES | CC1(OC(=O)COc2ccc([N+]3([O-])CCCCC3)c3ccccc23)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C28H35NO4/c1-28(21-14-19-13-20(16-21)17-22(28)15-19)33-27(30)18-32-26-10-9-25(23-7-3-4-8-24(23)26)29(31)11-5-2-6-12-29/h3-4,7-10,19-22H,2,5-6,11-18H2,1H3 |
| InChIKey | NSFIZBSGPPTNLL-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.59 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|