C13H12N3O8+ — CID 163819040
[2-[[5-(2,5-dioxopyrrol-1-yl)oxy-5-oxopentanoyl]-methylamino]oxy-2-oxoacetyl]-methylidyneazanium (PubChem CID 163819040) has the molecular formula C13H12N3O8+ and a molecular weight of 338.25 g/mol. Its IUPAC name is [2-[[5-(2,5-dioxopyrrol-1-yl)oxy-5-oxopentanoyl]-methylamino]oxy-2-oxoacetyl]-methylidyneazanium.
| Compound Name | [2-[[5-(2,5-dioxopyrrol-1-yl)oxy-5-oxopentanoyl]-methylamino]oxy-2-oxoacetyl]-methylidyneazanium |
|---|---|
| PubChem CID | 163819040 |
| Molecular Formula | C13H12N3O8+ |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | [2-[[5-(2,5-dioxopyrrol-1-yl)oxy-5-oxopentanoyl]-methylamino]oxy-2-oxoacetyl]-methylidyneazanium |
| SMILES | C#[N+]C(=O)C(=O)ON(C)C(=O)CCCC(=O)ON1C(=O)C=CC1=O |
| InChI | InChI=1S/C13H12N3O8/c1-14-12(21)13(22)24-15(2)8(17)4-3-5-11(20)23-16-9(18)6-7-10(16)19/h1,6-7H,3-5H2,2H3/q+1 |
| InChIKey | NTUZOGQNHMGTTM-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 131.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|