About cyclohexyl 1-(1-hydroxy-2,2-dimethylbut-3-enoxy)ethyl carbonate
cyclohexyl 1-(1-hydroxy-2,2-dimethylbut-3-enoxy)ethyl carbonate (PubChem CID 163819427) has the molecular formula C15H26O5
and a molecular weight of 286.37 g/mol. Its IUPAC name is cyclohexyl 1-(1-hydroxy-2,2-dimethylbut-3-enoxy)ethyl carbonate.
Molecular Properties
| Compound Name | cyclohexyl 1-(1-hydroxy-2,2-dimethylbut-3-enoxy)ethyl carbonate |
| PubChem CID | 163819427 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | cyclohexyl 1-(1-hydroxy-2,2-dimethylbut-3-enoxy)ethyl carbonate |
| SMILES | C=CC(C)(C)C(O)OC(C)OC(=O)OC1CCCCC1 |
| InChI | InChI=1S/C15H26O5/c1-5-15(3,4)13(16)18-11(2)19-14(17)20-12-9-7-6-8-10-12/h5,11-13,16H,1,6-10H2,2-4H3 |
| InChIKey | NUCZFSLLQXQEGW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyclohexyl 1-(1-hydroxy-2,2-dimethylbut-3-enoxy)ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl 1-(1-hydroxy-2,2-dimethylbut-3-enoxy)ethyl carbonate?
The IUPAC name of cyclohexyl 1-(1-hydroxy-2,2-dimethylbut-3-enoxy)ethyl carbonate (CID 163819427) is cyclohexyl 1-(1-hydroxy-2,2-dimethylbut-3-enoxy)ethyl carbonate.
What is the SMILES notation for cyclohexyl 1-(1-hydroxy-2,2-dimethylbut-3-enoxy)ethyl carbonate?
The canonical SMILES for cyclohexyl 1-(1-hydroxy-2,2-dimethylbut-3-enoxy)ethyl carbonate is C=CC(C)(C)C(O)OC(C)OC(=O)OC1CCCCC1.
What is the InChIKey of cyclohexyl 1-(1-hydroxy-2,2-dimethylbut-3-enoxy)ethyl carbonate?
The InChIKey is NUCZFSLLQXQEGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O5/c1-5-15(3,4)13(16)18-11(2)19-14(17)20-12-9-7-6-8-10-12/h5,11-13,16H,1,6-10H2,2-4H3.
What are the key properties of cyclohexyl 1-(1-hydroxy-2,2-dimethylbut-3-enoxy)ethyl carbonate?
cyclohexyl 1-(1-hydroxy-2,2-dimethylbut-3-enoxy)ethyl carbonate has a molecular weight of 286.37 g/mol, XLogP of 3.37, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl 1-(1-hydroxy-2,2-dimethylbut-3-enoxy)ethyl carbonate is sourced from PubChem (CID 163819427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).