C22H42BNO6S2 — CID 163843596
tert-butyl (3S)-6-[[(S)-tert-butylsulfinyl]amino]-3-(1-sulfanylethenoxy)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate (PubChem CID 163843596) has the molecular formula C22H42BNO6S2 and a molecular weight of 491.53 g/mol. Its IUPAC name is tert-butyl (3S)-6-[[(S)-tert-butylsulfinyl]amino]-3-(1-sulfanylethenoxy)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate.
| Compound Name | tert-butyl (3S)-6-[[(S)-tert-butylsulfinyl]amino]-3-(1-sulfanylethenoxy)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate |
|---|---|
| PubChem CID | 163843596 |
| Molecular Formula | C22H42BNO6S2 |
| Molecular Weight | 491.53 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | tert-butyl (3S)-6-[[(S)-tert-butylsulfinyl]amino]-3-(1-sulfanylethenoxy)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate |
| SMILES | C=C(S)O[C@@H](CCC(N[S@@](=O)C(C)(C)C)B1OC(C)(C)C(C)(C)O1)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H42BNO6S2/c1-15(31)27-16(14-18(25)28-19(2,3)4)12-13-17(24-32(26)20(5,6)7)23-29-21(8,9)22(10,11)30-23/h16-17,24,31H,1,12-14H2,2-11H3/t16-,17?,32-/m0/s1 |
| InChIKey | OOEFBLMQSPUFTE-XRILPDHYSA-N |
| XLogP | 4.34 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.53 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|