C19H17IO5 — CID 163846068
[(1S)-2,3-dihydroxy-5-oxo-7-oxaheptacyclo[10.7.1.01,6.02,15.08,20.014,19.015,17]icosa-8,10,12(20)-trien-9-yl] hypoiodite (PubChem CID 163846068) has the molecular formula C19H17IO5 and a molecular weight of 452.24 g/mol. Its IUPAC name is [(1S)-2,3-dihydroxy-5-oxo-7-oxaheptacyclo[10.7.1.01,6.02,15.08,20.014,19.015,17]icosa-8,10,12(20)-trien-9-yl] hypoiodite.
| Compound Name | [(1S)-2,3-dihydroxy-5-oxo-7-oxaheptacyclo[10.7.1.01,6.02,15.08,20.014,19.015,17]icosa-8,10,12(20)-trien-9-yl] hypoiodite |
|---|---|
| PubChem CID | 163846068 |
| Molecular Formula | C19H17IO5 |
| Molecular Weight | 452.24 g/mol |
| Exact Mass | 452.01 |
| IUPAC Name | [(1S)-2,3-dihydroxy-5-oxo-7-oxaheptacyclo[10.7.1.01,6.02,15.08,20.014,19.015,17]icosa-8,10,12(20)-trien-9-yl] hypoiodite |
| SMILES | O=C1CC(O)C2(O)C34CC3CC3C4Cc4ccc(OI)c5c4[C@]32C1O5 |
| InChI | InChI=1S/C19H17IO5/c20-25-12-2-1-7-3-9-10-4-8-6-17(8,9)19(23)13(22)5-11(21)16-18(10,19)14(7)15(12)24-16/h1-2,8-10,13,16,22-23H,3-6H2/t8?,9?,10?,13?,16?,17?,18-,19?/m0/s1 |
| InChIKey | OQGXUSHPAACVGR-DVADOQCGSA-N |
| XLogP | 1.69 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.24 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|