C21H36O2 — CID 163872715
[6-(dimethoxymethyl)-4,4,7,7-tetramethyloctan-3-yl]benzene (PubChem CID 163872715) has the molecular formula C21H36O2 and a molecular weight of 320.52 g/mol. Its IUPAC name is [6-(dimethoxymethyl)-4,4,7,7-tetramethyloctan-3-yl]benzene.
| Compound Name | [6-(dimethoxymethyl)-4,4,7,7-tetramethyloctan-3-yl]benzene |
|---|---|
| PubChem CID | 163872715 |
| Molecular Formula | C21H36O2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.27 |
| IUPAC Name | [6-(dimethoxymethyl)-4,4,7,7-tetramethyloctan-3-yl]benzene |
| SMILES | CCC(c1ccccc1)C(C)(C)CC(C(OC)OC)C(C)(C)C |
| InChI | InChI=1S/C21H36O2/c1-9-17(16-13-11-10-12-14-16)21(5,6)15-18(20(2,3)4)19(22-7)23-8/h10-14,17-19H,9,15H2,1-8H3 |
| InChIKey | PMFXRQIKQWYUMX-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|