C30H28O7U — CID 163892503
[9-methyl-6,8-bis(2-methylprop-2-enoyloxy)-3,9-dihydrofluoren-3-id-1-yl] 2-methylprop-2-enoate;2-methylprop-2-en-1-one;uranium(2+) (PubChem CID 163892503) has the molecular formula C30H28O7U and a molecular weight of 738.58 g/mol. Its IUPAC name is [9-methyl-6,8-bis(2-methylprop-2-enoyloxy)-3,9-dihydrofluoren-3-id-1-yl] 2-methylprop-2-enoate;2-methylprop-2-en-1-one;uranium(2+).
| Compound Name | [9-methyl-6,8-bis(2-methylprop-2-enoyloxy)-3,9-dihydrofluoren-3-id-1-yl] 2-methylprop-2-enoate;2-methylprop-2-en-1-one;uranium(2+) |
|---|---|
| PubChem CID | 163892503 |
| Molecular Formula | C30H28O7U |
| Molecular Weight | 738.58 g/mol |
| Exact Mass | 738.23 |
| IUPAC Name | [9-methyl-6,8-bis(2-methylprop-2-enoyloxy)-3,9-dihydrofluoren-3-id-1-yl] 2-methylprop-2-enoate;2-methylprop-2-en-1-one;uranium(2+) |
| SMILES | C=C(C)C(=O)Oc1cc(OC(=O)C(=C)C)c2c(c1)-c1c[c-]cc(OC(=O)C(=C)C)c1C2C.C=C(C)[C-]=O.[U+2] |
| InChI | InChI=1S/C26H23O6.C4H5O.U/c1-13(2)24(27)30-17-11-19-18-9-8-10-20(31-25(28)14(3)4)22(18)16(7)23(19)21(12-17)32-26(29)15(5)6;1-4(2)3-5;/h9-12,16H,1,3,5H2,2,4,6-7H3;1H2,2H3;/q2*-1;+2 |
| InChIKey | JIESAYKBTJKTML-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.58 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|