C30H32O8 — CID 130280777
[4,7-bis(1-hydroxy-2-methylprop-2-enoxy)-9-methyl-5-(2-methylprop-2-enoyloxy)-9H-fluoren-2-yl] 2-methylprop-2-enoate (PubChem CID 130280777) has the molecular formula C30H32O8 and a molecular weight of 520.58 g/mol. Its IUPAC name is [4,7-bis(1-hydroxy-2-methylprop-2-enoxy)-9-methyl-5-(2-methylprop-2-enoyloxy)-9H-fluoren-2-yl] 2-methylprop-2-enoate.
| Compound Name | [4,7-bis(1-hydroxy-2-methylprop-2-enoxy)-9-methyl-5-(2-methylprop-2-enoyloxy)-9H-fluoren-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 130280777 |
| Molecular Formula | C30H32O8 |
| Molecular Weight | 520.58 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | [4,7-bis(1-hydroxy-2-methylprop-2-enoxy)-9-methyl-5-(2-methylprop-2-enoyloxy)-9H-fluoren-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1cc(OC(O)C(=C)C)c2c(c1)C(C)c1cc(OC(O)C(=C)C)cc(OC(=O)C(=C)C)c1-2 |
| InChI | InChI=1S/C30H32O8/c1-14(2)27(31)35-19-10-21-18(9)22-11-20(36-28(32)15(3)4)13-24(38-30(34)17(7)8)26(22)25(21)23(12-19)37-29(33)16(5)6/h10-13,18,27,30-31,34H,1,3,5,7H2,2,4,6,8-9H3 |
| InChIKey | BXFFSMKCKCUHOC-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.58 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|