C19H10O7 — CID 163894661
7-(1,3-dioxo-2-benzofuran-5-carbonyl)-1,5-dihydro-3-benzoxepine-2,4-dione (PubChem CID 163894661) has the molecular formula C19H10O7 and a molecular weight of 350.28 g/mol. Its IUPAC name is 7-(1,3-dioxo-2-benzofuran-5-carbonyl)-1,5-dihydro-3-benzoxepine-2,4-dione.
| Compound Name | 7-(1,3-dioxo-2-benzofuran-5-carbonyl)-1,5-dihydro-3-benzoxepine-2,4-dione |
|---|---|
| PubChem CID | 163894661 |
| Molecular Formula | C19H10O7 |
| Molecular Weight | 350.28 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | 7-(1,3-dioxo-2-benzofuran-5-carbonyl)-1,5-dihydro-3-benzoxepine-2,4-dione |
| SMILES | O=C1Cc2ccc(C(=O)c3ccc4c(c3)C(=O)OC4=O)cc2CC(=O)O1 |
| InChI | InChI=1S/C19H10O7/c20-15-7-9-1-2-10(5-12(9)8-16(21)25-15)17(22)11-3-4-13-14(6-11)19(24)26-18(13)23/h1-6H,7-8H2 |
| InChIKey | QEOHYIAKXXQUCB-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.28 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|