C27H10FIN4 — CID 163932478
2-[10-(dicyanomethylidene)-2-fluoro-8-(methylidene-λ3-iodanyl)indeno[2,1-b]fluoren-12-ylidene]propanedinitrile (PubChem CID 163932478) has the molecular formula C27H10FIN4 and a molecular weight of 536.31 g/mol. Its IUPAC name is 2-[10-(dicyanomethylidene)-2-fluoro-8-(methylidene-λ3-iodanyl)indeno[2,1-b]fluoren-12-ylidene]propanedinitrile.
| Compound Name | 2-[10-(dicyanomethylidene)-2-fluoro-8-(methylidene-λ3-iodanyl)indeno[2,1-b]fluoren-12-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 163932478 |
| Molecular Formula | C27H10FIN4 |
| Molecular Weight | 536.31 g/mol |
| Exact Mass | 535.99 |
| IUPAC Name | 2-[10-(dicyanomethylidene)-2-fluoro-8-(methylidene-λ3-iodanyl)indeno[2,1-b]fluoren-12-ylidene]propanedinitrile |
| SMILES | C=Ic1ccc2c(c1)C(=C(C#N)C#N)c1cc3c(cc1-2)-c1ccc(F)cc1C3=C(C#N)C#N |
| InChI | InChI=1S/C27H10FIN4/c1-29-17-3-5-19-21-8-20-18-4-2-16(28)6-22(18)26(14(10-30)11-31)24(20)9-25(21)27(23(19)7-17)15(12-32)13-33/h2-9H,1H2 |
| InChIKey | RJWAWGPWMZSRGG-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.31 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|