C39H20F2N4 — CID 165019148
2-[10-(dicyanomethylidene)-8-(4-fluoro-6-methylcyclohexa-1,3-dien-1-yl)-2-(4-fluorophenyl)indeno[2,1-b]fluoren-12-ylidene]propanedinitrile (PubChem CID 165019148) has the molecular formula C39H20F2N4 and a molecular weight of 582.61 g/mol. Its IUPAC name is 2-[10-(dicyanomethylidene)-8-(4-fluoro-6-methylcyclohexa-1,3-dien-1-yl)-2-(4-fluorophenyl)indeno[2,1-b]fluoren-12-ylidene]propanedinitrile.
| Compound Name | 2-[10-(dicyanomethylidene)-8-(4-fluoro-6-methylcyclohexa-1,3-dien-1-yl)-2-(4-fluorophenyl)indeno[2,1-b]fluoren-12-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 165019148 |
| Molecular Formula | C39H20F2N4 |
| Molecular Weight | 582.61 g/mol |
| Exact Mass | 582.17 |
| IUPAC Name | 2-[10-(dicyanomethylidene)-8-(4-fluoro-6-methylcyclohexa-1,3-dien-1-yl)-2-(4-fluorophenyl)indeno[2,1-b]fluoren-12-ylidene]propanedinitrile |
| SMILES | CC1CC(F)=CC=C1c1ccc2c(c1)C(=C(C#N)C#N)c1cc3c(cc1-2)-c1ccc(-c2ccc(F)cc2)cc1C3=C(C#N)C#N |
| InChI | InChI=1S/C39H20F2N4/c1-21-12-28(41)8-11-29(21)24-5-10-31-33-15-32-30-9-4-23(22-2-6-27(40)7-3-22)13-34(30)38(25(17-42)18-43)36(32)16-37(33)39(35(31)14-24)26(19-44)20-45/h2-11,13-16,21H,12H2,1H3 |
| InChIKey | KWYFYBBRQHBUGE-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.61 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|