C38H8F10N4O2S2 — CID 139501644
2-[10-(dicyanomethylidene)-2,8-bis[(2,3,4,5,6-pentafluorophenyl)sulfinyl]indeno[2,1-b]fluoren-12-ylidene]propanedinitrile (PubChem CID 139501644) has the molecular formula C38H8F10N4O2S2 and a molecular weight of 806.62 g/mol. Its IUPAC name is 2-[10-(dicyanomethylidene)-2,8-bis[(2,3,4,5,6-pentafluorophenyl)sulfinyl]indeno[2,1-b]fluoren-12-ylidene]propanedinitrile.
| Compound Name | 2-[10-(dicyanomethylidene)-2,8-bis[(2,3,4,5,6-pentafluorophenyl)sulfinyl]indeno[2,1-b]fluoren-12-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 139501644 |
| Molecular Formula | C38H8F10N4O2S2 |
| Molecular Weight | 806.62 g/mol |
| Exact Mass | 805.99 |
| IUPAC Name | 2-[10-(dicyanomethylidene)-2,8-bis[(2,3,4,5,6-pentafluorophenyl)sulfinyl]indeno[2,1-b]fluoren-12-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1c2cc(S(=O)c3c(F)c(F)c(F)c(F)c3F)ccc2-c2cc3c(cc21)C(=C(C#N)C#N)c1cc(S(=O)c2c(F)c(F)c(F)c(F)c2F)ccc1-3 |
| InChI | InChI=1S/C38H8F10N4O2S2/c39-27-29(41)33(45)37(34(46)30(27)42)55(53)15-1-3-17-19-7-20-18-4-2-16(56(54)38-35(47)31(43)28(40)32(44)36(38)48)6-22(18)26(14(11-51)12-52)24(20)8-23(19)25(21(17)5-15)13(9-49)10-50/h1-8H |
| InChIKey | VRDGWWWMPBSVGW-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 129.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.62 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|