C26H21F3IO2+ — CID 163937368
bis(4-phenoxyphenyl)iodanium;1,1,1-trifluoroethane (PubChem CID 163937368) has the molecular formula C26H21F3IO2+ and a molecular weight of 549.35 g/mol. Its IUPAC name is bis(4-phenoxyphenyl)iodanium;1,1,1-trifluoroethane.
| Compound Name | bis(4-phenoxyphenyl)iodanium;1,1,1-trifluoroethane |
|---|---|
| PubChem CID | 163937368 |
| Molecular Formula | C26H21F3IO2+ |
| Molecular Weight | 549.35 g/mol |
| Exact Mass | 549.05 |
| IUPAC Name | bis(4-phenoxyphenyl)iodanium;1,1,1-trifluoroethane |
| SMILES | CC(F)(F)F.c1ccc(Oc2ccc([I+]c3ccc(Oc4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C24H18IO2.C2H3F3/c1-3-7-21(8-4-1)26-23-15-11-19(12-16-23)25-20-13-17-24(18-14-20)27-22-9-5-2-6-10-22;1-2(3,4)5/h1-18H;1H3/q+1; |
| InChIKey | RNYSKKDAZDZYRM-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.35 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|