C14H25N — CID 163982541
2,4-ditert-butyl-1,3-dimethylpyrrole (PubChem CID 163982541) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is 2,4-ditert-butyl-1,3-dimethylpyrrole.
| Compound Name | 2,4-ditert-butyl-1,3-dimethylpyrrole |
|---|---|
| PubChem CID | 163982541 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | 2,4-ditert-butyl-1,3-dimethylpyrrole |
| SMILES | Cc1c(C(C)(C)C)cn(C)c1C(C)(C)C |
| InChI | InChI=1S/C14H25N/c1-10-11(13(2,3)4)9-15(8)12(10)14(5,6)7/h9H,1-8H3 |
| InChIKey | KDYMIFOPWKVKQI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |