C17H28NP — CID 175618596
[(1E)-1-(3,4-ditert-butyl-1-methylpyrrol-2-yl)buta-1,3-dienyl]phosphane (PubChem CID 175618596) has the molecular formula C17H28NP and a molecular weight of 277.39 g/mol. Its IUPAC name is [(1E)-1-(3,4-ditert-butyl-1-methylpyrrol-2-yl)buta-1,3-dienyl]phosphane.
| Compound Name | [(1E)-1-(3,4-ditert-butyl-1-methylpyrrol-2-yl)buta-1,3-dienyl]phosphane |
|---|---|
| PubChem CID | 175618596 |
| Molecular Formula | C17H28NP |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | [(1E)-1-(3,4-ditert-butyl-1-methylpyrrol-2-yl)buta-1,3-dienyl]phosphane |
| SMILES | C=C/C=C(/P)c1c(C(C)(C)C)c(C(C)(C)C)cn1C |
| InChI | InChI=1S/C17H28NP/c1-9-10-13(19)15-14(17(5,6)7)12(11-18(15)8)16(2,3)4/h9-11H,1,19H2,2-8H3/b13-10+ |
| InChIKey | JAFNCNBSEVBNEP-JLHYYAGUSA-N |
| XLogP | 5.02 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|